Products 878339-23-2
CAS 878339-23-2 appears in our catalog under these names: L-Phenylalanine -13C9-15N, L–Phenylalanine–13C9,15N, L-PHENYLALANINE-13C9,15N, 95% CP, 98 ATO, L-Phenylalanine-¹³C₉,¹⁵N, L-Phenylalanine-13C9,15N, 99.52%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 50mg, 10mg, 25mg, 5mg, 1G, 250MG, 25 mg, 50 mg.
(2S)-2-(15N)azanyl-3-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3-13C3)propanoic acid (CAS 878339-23-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 175.117 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3-13C3)propanoic acid. InChIKey: COLNVLDHVKWLRT-CMLFETTRSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 175.117 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3-13C3)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-CMLFETTRSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[13CH2][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)