Products 878414-63-2
CAS 878414-63-2 is the registry number for 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde (CAS 878414-63-2) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde. InChIKey: MYZRYTYZNHXGQA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
| InChIKey | MYZRYTYZNHXGQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C=NN12)C=O)C |
Computed by PubChem (NCBI)