Products 878742-33-7
CAS 878742-33-7 appears in our catalog under these names: 5-(Piperidin-1-yl)nicotinic acid, 95%, 5–(Piperidin–1–yl)nicotinic acid. Offered by: Combi-blocks, GLPBio, Ambeed, BLDpharm. Available pack sizes: 100mg, 1g, 250mg.
5-piperidin-1-ylpyridine-3-carboxylic acid (CAS 878742-33-7) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 5-piperidin-1-ylpyridine-3-carboxylic acid. InChIKey: UWDWYCKLOPCIOM-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5-piperidin-1-ylpyridine-3-carboxylic acid |
| InChIKey | UWDWYCKLOPCIOM-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)