CAS 878744-20-8 appears in our catalog under these names: 2-(Aminomethyl)-4-methylthiazole-5-carboxylic acid hydrochloride, 95%, 2-(Aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride (CAS 878744-20-8) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride. InChIKey: NXRGWUMGLZKFKP-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
| InChIKey | NXRGWUMGLZKFKP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)