CAS 87884-14-8 appears in our catalog under these names: Methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-4-oxobutanoate, 95%, Methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-4-oxobutanoate, Methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoate, 95%, 95%, Methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoate, 95%, methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoate, >95%. Offered by: AmBeed, Biosynth, Chemat, BLDpharm. Available pack sizes: 5g, 0,5g, 50mg, 1g, 100mg, 250mg.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 87884-14-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: YRBARHABTATAFQ-ZETCQYMHSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | YRBARHABTATAFQ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=O)C(=O)OC |
Computed by PubChem (NCBI)