Products 879-48-1
CAS 879-48-1 appears in our catalog under these names: Phenylglycine Ethyl Ester Hydrochloride, H-DL-2-Phg-OEt·HCl 98%, Ethyl 2-amino-2-phenylacetate hydrochloride, 97%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 5g, 25g, 100g, 500g.
Ethyl 2-amino-2-phenylacetate;hydrochloride (CAS 879-48-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: ethyl 2-amino-2-phenylacetate;hydrochloride. InChIKey: FNNXQLSKQSVNLL-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | ethyl 2-amino-2-phenylacetate;hydrochloride |
| InChIKey | FNNXQLSKQSVNLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
ethyl 2-amino-2-phenylacetate hydrochloride, Phenylglycine ethyl ester hydrochloride, DL-Phenylglycine ethyl ester hydrochloride, ethyl 2-amino-2-phenylacetate;hydrochloride, D-(-)-Alpha-Phenylglycine Ethyl Ester Hydrochloride, Benzeneacetic acid, alpha-amino-, ethyl ester, hydrochloride, (1R)-2-ethoxy-2-oxo-1-phenylethan-1-aminium chloride, Ethyl 2-amino-2-phenylacetate, HCl, Ethyl phenylglycinate hydrochloride, DL-, ethyl 2-amino-2-phenylacetate,hydrochloride