Products 879325-07-2
CAS 879325-07-2 appears in our catalog under these names: Protoapigenin, Protoapigenin, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
2-(1,4-dihydroxycyclohexa-2,5-dien-1-yl)-5,7-dihydroxychromen-4-one (CAS 879325-07-2) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 2-(1,4-dihydroxycyclohexa-2,5-dien-1-yl)-5,7-dihydroxychromen-4-one. InChIKey: BXZYQTCXZAHTCI-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 2-(1,4-dihydroxycyclohexa-2,5-dien-1-yl)-5,7-dihydroxychromen-4-one |
| InChIKey | BXZYQTCXZAHTCI-UHFFFAOYSA-N |
| SMILES | C1=CC(C=CC1O)(C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Protoapigenin, orb1943398