CAS 880349-08-6 is the registry number for 4-BROMO-1-METHYL-1H-INDOLE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-1-methylindole-2-carboxylic acid (CAS 880349-08-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 4-bromo-1-methylindole-2-carboxylic acid. InChIKey: DEBMMRJSRWYGGA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-bromo-1-methylindole-2-carboxylic acid |
| InChIKey | DEBMMRJSRWYGGA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C1C(=O)O)C(=CC=C2)Br |
Computed by PubChem (NCBI)