CAS 88039-46-7 appears in our catalog under these names: INF 4E, NLRP3-IN-9, INF 4E, INF4E, 99.38%, Ethyl 2-((2-chlorophenyl)(hydroxy)methyl)acrylate, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 750mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL.
Ethyl 2-[(2-chlorophenyl)-hydroxymethyl]prop-2-enoate (CAS 88039-46-7) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl 2-[(2-chlorophenyl)-hydroxymethyl]prop-2-enoate. InChIKey: BSRPDXCMAOIUOO-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | ethyl 2-[(2-chlorophenyl)-hydroxymethyl]prop-2-enoate |
| InChIKey | BSRPDXCMAOIUOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)C(C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)