Products 881376-41-6
CAS 881376-41-6 appears in our catalog under these names: Pinoxaden Metabolite SYN505164, 4’Desmethyl-4’Hydroxymethyl Pinoxaden Despivoloyl, Pinoxaden M4 SYN 505164, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 1g, 1x1ml.
8-[2,6-diethyl-4-(hydroxymethyl)phenyl]-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepine-7,9-dione (CAS 881376-41-6) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: 8-[2,6-diethyl-4-(hydroxymethyl)phenyl]-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepine-7,9-dione. InChIKey: VRDNISIPMVBPNW-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 8-[2,6-diethyl-4-(hydroxymethyl)phenyl]-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepine-7,9-dione |
| InChIKey | VRDNISIPMVBPNW-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC(=C1C2C(=O)N3CCOCCN3C2=O)CC)CO |
Computed by PubChem (NCBI)