CAS 882406-40-8 appears in our catalog under these names: 2-(2,4-Difluorophenyl)-2-methyl-1,3-dioxolane, 97%, 2-(2,4-Difluorophenyl)-2-methyl-1,3-dioxolane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(2,4-difluorophenyl)-2-methyl-1,3-dioxolane (CAS 882406-40-8) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-2-methyl-1,3-dioxolane. InChIKey: QCMWISPHRSKFQW-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | QCMWISPHRSKFQW-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)