CAS 883-87-4 is the registry number for Salsolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg.
(1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 883-87-4) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: UJXLTDHDLUBZBL-QRPNPIFTSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | UJXLTDHDLUBZBL-QRPNPIFTSA-N |
| SMILES | C[C@H]1C2=CC(=C(C=C2CCN1)OC)OC.Cl |
Computed by PubChem (NCBI)