CAS 88311-79-9 is the registry number for 5-Mesitylcyclohexane-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (CAS 88311-79-9) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione. InChIKey: RGCPDRWZRFMXHQ-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| InChIKey | RGCPDRWZRFMXHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2CC(=O)CC(=O)C2)C |
Computed by PubChem (NCBI)