CAS 883265-08-5 is the registry number for 1-(3-((2-chlorophenyl)amino)-5-methyl-2,4-thiazolyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 10g, 5g.
1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 883265-08-5) is a chemical compound with the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. IUPAC name: 1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: BDJIWPJRSNPPIX-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2OS |
|---|---|
| Molecular weight | 266.75 g/mol |
| IUPAC name | 1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | BDJIWPJRSNPPIX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=CC=C2Cl)C(=O)C |
Computed by PubChem (NCBI)