Products 883290-81-1
CAS 883290-81-1 appears in our catalog under these names: 4-[(Carboxymethyl)(methyl)amino]benzoic acid, 95%, 4-((Carboxymethyl)(methyl)amino)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-[carboxymethyl(methyl)amino]benzoic acid (CAS 883290-81-1) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 4-[carboxymethyl(methyl)amino]benzoic acid. InChIKey: IOOSPZLSDWROKW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-[carboxymethyl(methyl)amino]benzoic acid |
| InChIKey | IOOSPZLSDWROKW-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)