CAS 883550-10-5 is the registry number for (3,7-Dimethyl-5-oxo-5,8-dihydro-(1,2,4)triazolo-(4,3-a)pyrimidin-6-yl)-acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)acetic acid (CAS 883550-10-5) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)acetic acid. InChIKey: GLFFVDKRQIEDRA-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)acetic acid |
| InChIKey | GLFFVDKRQIEDRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=NNC2=N1)C)CC(=O)O |
Computed by PubChem (NCBI)