Products 883554-93-6
CAS 883554-93-6 appears in our catalog under these names: Methyl 5-bromo-2-nitrobenzoate, Methyl 5-bromo-2-nitrobenzoate 98%, Benzoic acid, 5-bromo-2-nitro-, methyl ester, 98%, 98%, 5-Bromo-2-nitro-benzoic acid methyl ester, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250g, 500g, 1g, 5g, 10g, 25g.
Methyl 5-bromo-2-nitrobenzoate (CAS 883554-93-6) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 5-bromo-2-nitrobenzoate. InChIKey: IXVNSGSUEVSJIF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 5-bromo-2-nitrobenzoate |
| InChIKey | IXVNSGSUEVSJIF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)