Products 88371-27-1
CAS 88371-27-1 is the registry number for 1-Benzyl-2-oxo-1,2,3,4-tetrahydroquinoline-6-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-2-oxo-3,4-dihydroquinoline-6-carboxylic acid (CAS 88371-27-1) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 1-benzyl-2-oxo-3,4-dihydroquinoline-6-carboxylic acid. InChIKey: NNYPUFIJXFELMZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 1-benzyl-2-oxo-3,4-dihydroquinoline-6-carboxylic acid |
| InChIKey | NNYPUFIJXFELMZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C2=C1C=C(C=C2)C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)