Products 884504-86-3
CAS 884504-86-3 appears in our catalog under these names: 3-(2-oxoimidazolidin-1-yl)benzoic Acid, 3-(2-Oxoimidazolidin-1-yl)benzoic acid, 95%, 3-(2-Oxo-imidazolidin-1-yl)benzoic acid. Offered by: TRC, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2g.
3-(2-oxoimidazolidin-1-yl)benzoic acid (CAS 884504-86-3) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 3-(2-oxoimidazolidin-1-yl)benzoic acid. InChIKey: REVYTXLGZSYHEG-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 3-(2-oxoimidazolidin-1-yl)benzoic acid |
| InChIKey | REVYTXLGZSYHEG-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)