CAS 885266-62-6 is the registry number for 8-Fluoro-2,2-dimethylchroman-4-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
8-fluoro-2,2-dimethyl-3H-chromen-4-one (CAS 885266-62-6) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 8-fluoro-2,2-dimethyl-3H-chromen-4-one. InChIKey: AZYHMVLQDDDWCY-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 8-fluoro-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | AZYHMVLQDDDWCY-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C(=CC=C2)F)C |
Computed by PubChem (NCBI)