CAS 885270-30-4 appears in our catalog under these names: 1–Boc–4–aminoindole, 1-Boc-4-aminoindole, 1-Boc-4-Aminoindole, 96%, 1-Boc-4-Amino-1H-indole, >97%, 1-Boc-4-Amino-1H-indole, >97%, >97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 2g, 100mg, 10g.
Tert-butyl 4-aminoindole-1-carboxylate (CAS 885270-30-4) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl 4-aminoindole-1-carboxylate. InChIKey: OKLWIGZVXJTALB-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl 4-aminoindole-1-carboxylate |
| InChIKey | OKLWIGZVXJTALB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C(C=CC=C21)N |
Computed by PubChem (NCBI)