CAS 885272-22-0 appears in our catalog under these names: 1H–Indole–4–carboxylic acid hydrazide, 1H-Indole-4-carbohydrazide 95%, 1H-Indole-4-carboxylic acid, hydrazide, 95%, 95%, 1H-Indole-4-carbohydrazide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
1H-indole-4-carbohydrazide (CAS 885272-22-0) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 1H-indole-4-carbohydrazide. InChIKey: VFWVCNABVVHCKS-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1H-indole-4-carbohydrazide |
| InChIKey | VFWVCNABVVHCKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CNC2=C1)C(=O)NN |
Computed by PubChem (NCBI)