CAS 885275-20-7 is the registry number for 1-Boc-4-chloro-5-formyl-3,6-dihydro-2h-pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 4-chloro-5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 885275-20-7) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: tert-butyl 4-chloro-5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: KHJZRPYVBQGUNI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | tert-butyl 4-chloro-5-formyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | KHJZRPYVBQGUNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=C(C1)C=O)Cl |
Computed by PubChem (NCBI)