Products 885312-78-7
CAS 885312-78-7 is the registry number for Ethyl 4-(cyclopentylamino)-3-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 4-(cyclopentylamino)-3-nitrobenzoate (CAS 885312-78-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: ethyl 4-(cyclopentylamino)-3-nitrobenzoate. InChIKey: CVVMBCXAIQNESO-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | ethyl 4-(cyclopentylamino)-3-nitrobenzoate |
| InChIKey | CVVMBCXAIQNESO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)NC2CCCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)