CAS 885468-36-0 is the registry number for 2-(3-Bromophenyl)pyrimidine, 95+%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(3-bromophenyl)pyrimidine (CAS 885468-36-0) is a chemical compound with the molecular formula C10H7BrN2 and a molecular weight of 235.08 g/mol. IUPAC name: 2-(3-bromophenyl)pyrimidine. InChIKey: CETLQDSNTJEASI-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 2-(3-bromophenyl)pyrimidine |
| InChIKey | CETLQDSNTJEASI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC=CC=N2 |
Computed by PubChem (NCBI)