CAS 885518-83-2 appears in our catalog under these names: 4-Nitro-1H-indazol-6-ol, 95+%, 4-Nitro-1H-indazol-6-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-nitro-1H-indazol-6-ol (CAS 885518-83-2) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 4-nitro-1H-indazol-6-ol. InChIKey: BJMMZNBQVYKORW-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 4-nitro-1H-indazol-6-ol |
| InChIKey | BJMMZNBQVYKORW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NN=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)