Products 885519-19-7
CAS 885519-19-7 is the registry number for Methyl 4-chloro-1H-indazole-6-carboxylate, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
Methyl 4-chloro-1H-indazole-6-carboxylate (CAS 885519-19-7) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 4-chloro-1H-indazole-6-carboxylate. InChIKey: BRRIKQXUDWIOIL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 4-chloro-1H-indazole-6-carboxylate |
| InChIKey | BRRIKQXUDWIOIL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=NN2)C(=C1)Cl |
Computed by PubChem (NCBI)