CAS 885520-66-1 is the registry number for 6-Methoxy-4-nitro-1H-indole, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
6-methoxy-4-nitro-1H-indole (CAS 885520-66-1) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-4-nitro-1H-indole. InChIKey: RLVKBTVJWNDOSQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-4-nitro-1H-indole |
| InChIKey | RLVKBTVJWNDOSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)