CAS 885590-85-2 appears in our catalog under these names: 2-(2,3-Difluorophenyl)-2-methyl-[1,3]dioxolane, 97%, 2-(2,3-Difluorophenyl)-2-methyl-[1,3]dioxolane, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
2-(2,3-difluorophenyl)-2-methyl-1,3-dioxolane (CAS 885590-85-2) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2-(2,3-difluorophenyl)-2-methyl-1,3-dioxolane. InChIKey: KDRHYLGDTFLFPY-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | KDRHYLGDTFLFPY-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)