Products 885679-87-8
CAS 885679-87-8 is the registry number for 3-rac-Ochratoxin B tert-Butyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
Tert-butyl 2-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl)amino]-3-phenylpropanoate (CAS 885679-87-8) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: tert-butyl 2-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl)amino]-3-phenylpropanoate. InChIKey: APQQFSDCMFGQLY-UHFFFAOYSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | tert-butyl 2-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl)amino]-3-phenylpropanoate |
| InChIKey | APQQFSDCMFGQLY-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=C(C=C2)C(=O)NC(CC3=CC=CC=C3)C(=O)OC(C)(C)C)O)C(=O)O1 |
Computed by PubChem (NCBI)
Synonyms:
3-rac-Ochratoxin B tert-Butyl Ester