CAS 886221-90-5 is the registry number for 1-{6-chloropyrazolo[1,5-a]pyridin-3-yl}ethan-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(6-chloropyrazolo[1,5-a]pyridin-3-yl)ethanone (CAS 886221-90-5) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 1-(6-chloropyrazolo[1,5-a]pyridin-3-yl)ethanone. InChIKey: JHMXOYABKCWISS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 1-(6-chloropyrazolo[1,5-a]pyridin-3-yl)ethanone |
| InChIKey | JHMXOYABKCWISS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C=CC(=CN2N=C1)Cl |
Computed by PubChem (NCBI)