Products 886363-21-9
CAS 886363-21-9 appears in our catalog under these names: 2-(3,5-Difluorophenyl)benzoic acid, 95%, 3',5'-Difluoro-(1,1'-biphenyl)-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 25g.
2-(3,5-difluorophenyl)benzoic acid (CAS 886363-21-9) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 2-(3,5-difluorophenyl)benzoic acid. InChIKey: FMRKSLAIPVOBEK-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)benzoic acid |
| InChIKey | FMRKSLAIPVOBEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3',5'-Difluoro[1,1'-biphenyl]-2-carboxylic acid, 3',5'-Difluoro(1,1'-biphenyl)-2-carboxylic acid, 2-biphenyl-3',5'-difluoro-carboxylic acid, 3',5'-Difluoro-[1,1'-biphenyl]-2-carboxylic acid, 3',5'-Difluoro-[1,1'-biphenyl]-2-carboxylicacid, 3',5'-difluoro-biphenyl-2-carboxylic acid, 2-Biphenyl-3',5'-difluorocarboxylic acid, 3',5'-Difluoro-2-biphenylcarboxylic acid