CAS 886365-74-8 appears in our catalog under these names: 2-(5-Chloromethyl-[1,2,4]oxadiazol-3-yl)-aniline, 95%, 2-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 886365-74-8) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: KFBPWVGVJYBSGY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | KFBPWVGVJYBSGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCl)N |
Computed by PubChem (NCBI)