CAS 886503-52-2 appears in our catalog under these names: 2–Trifluoromethoxy–4–methoxybenzaldehyde, 2-Trifluoromethoxy-4-methoxybenzaldehyde, 95%, 4-Methoxy-2-(trifluoromethoxy)benzaldehyde 97%, 2-Trifluoromethoxy-4-methoxybenzaldehyde, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
4-methoxy-2-(trifluoromethoxy)benzaldehyde (CAS 886503-52-2) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethoxy)benzaldehyde. InChIKey: NPUIWDQXZDLZIM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 4-methoxy-2-(trifluoromethoxy)benzaldehyde |
| InChIKey | NPUIWDQXZDLZIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C=O)OC(F)(F)F |
Computed by PubChem (NCBI)