Products 886762-89-6
CAS 886762-89-6 is the registry number for 6,8-Dichlorochroman-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
6,8-dichloro-3,4-dihydro-2H-chromen-4-amine (CAS 886762-89-6) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydro-2H-chromen-4-amine. InChIKey: KJGMEAMNMDDGQA-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | KJGMEAMNMDDGQA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)