CAS 88681-63-4 appears in our catalog under these names: (2Z)-2-(Acetylamino)-3-(4-chlorophenyl)acrylic acid, 90%, 2-Propenoic acid,2-(acetylamino)-3-(4-chlorophenyl)-, (2Z)-, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 25g.
(Z)-2-acetamido-3-(4-chlorophenyl)prop-2-enoic acid (CAS 88681-63-4) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: (Z)-2-acetamido-3-(4-chlorophenyl)prop-2-enoic acid. InChIKey: SWUMDDFBFZVMFJ-POHAHGRESA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | (Z)-2-acetamido-3-(4-chlorophenyl)prop-2-enoic acid |
| InChIKey | SWUMDDFBFZVMFJ-POHAHGRESA-N |
| SMILES | CC(=O)N/C(=C\C1=CC=C(C=C1)Cl)/C(=O)O |
Computed by PubChem (NCBI)