Products 88728-56-7
CAS 88728-56-7 is the registry number for Encecalinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanol (CAS 88728-56-7) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanol. InChIKey: ZMQPULSGBXIVGC-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanol |
| InChIKey | ZMQPULSGBXIVGC-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C2C(=C1)C=CC(O2)(C)C)OC)O |
Computed by PubChem (NCBI)