CAS 887405-28-9 appears in our catalog under these names: 3-Imidazo[1,2-a]pyridin-2-ylpropanoic acid, 95%, 3-(Imidazo(1,2-a)pyridin-2-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-imidazo[1,2-a]pyridin-2-ylpropanoic acid (CAS 887405-28-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid. InChIKey: WUAVUQJOFIIVHX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid |
| InChIKey | WUAVUQJOFIIVHX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)CCC(=O)O |
Computed by PubChem (NCBI)