CAS 887572-60-3 appears in our catalog under these names: 5-Methoxy-1H-benzo[d]imidazole-2-carboxylic acid, 96%, 5-Methoxy-1H-benzo(d)imidazole-2-carboxylic acid, 95+%, 5-Methoxy-1H-benzo[d]imidazole-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
6-methoxy-1H-benzimidazole-2-carboxylic acid (CAS 887572-60-3) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1H-benzimidazole-2-carboxylic acid. InChIKey: GYPYWLKJBRSMIM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1H-benzimidazole-2-carboxylic acid |
| InChIKey | GYPYWLKJBRSMIM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)C(=O)O |
Computed by PubChem (NCBI)