CAS 887595-89-3 is the registry number for 1-(3-Aminophenyl)-3-azetidinecarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Methyl 1-(3-aminophenyl)azetidine-3-carboxylate (CAS 887595-89-3) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 1-(3-aminophenyl)azetidine-3-carboxylate. InChIKey: NLLBYBVPFFXLPF-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 1-(3-aminophenyl)azetidine-3-carboxylate |
| InChIKey | NLLBYBVPFFXLPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)