CAS 88765-77-9 appears in our catalog under these names: 3-(1H-1,3-Benzodiazol-2-yl)propan-1-amine dihydrochloride, 3-(1H-Benzo[d]imidazol-2-yl)propan-1-amine dihydrochloride, 98%, 98%, 3-(1h-Benzo[d]imidazol-2-yl)propan-1-amine dihydrochloride, 95+%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg, 100g.
3-(1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride (CAS 88765-77-9) is a chemical compound with the molecular formula C10H15Cl2N3 and a molecular weight of 248.15 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride. InChIKey: FKTASQBFLHXILH-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 3-(1H-benzimidazol-2-yl)propan-1-amine;dihydrochloride |
| InChIKey | FKTASQBFLHXILH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CCCN.Cl.Cl |
Computed by PubChem (NCBI)