Products 887973-42-4
CAS 887973-42-4 is the registry number for 5-(3,4-Dimethoxyphenyl)nicotinic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(3,4-dimethoxyphenyl)pyridine-3-carboxylic acid (CAS 887973-42-4) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)pyridine-3-carboxylic acid. InChIKey: MKKNTDWMTBRGCD-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)pyridine-3-carboxylic acid |
| InChIKey | MKKNTDWMTBRGCD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=CN=C2)C(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
5-(3.4-Dimethoxyphenyl)-nicotinic acid