Products 887976-70-7
CAS 887976-70-7 is the registry number for 6-(3,5-Dichlorophenyl)nicotinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(3,5-dichlorophenyl)pyridine-3-carboxylic acid (CAS 887976-70-7) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 6-(3,5-dichlorophenyl)pyridine-3-carboxylic acid. InChIKey: GPUUXDZIZHGFQS-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 6-(3,5-dichlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | GPUUXDZIZHGFQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)