Products 859940-64-0
CAS 859940-64-0 appears in our catalog under these names: 1,3-Dichloro-5-(3-nitrophenyl)benzene, 98%, 3,5-Dichloro-3'-nitro-1,1'-biphenyl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
1,3-dichloro-5-(3-nitrophenyl)benzene (CAS 859940-64-0) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 1,3-dichloro-5-(3-nitrophenyl)benzene. InChIKey: XTBNXSKCTLZMHG-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 1,3-dichloro-5-(3-nitrophenyl)benzene |
| InChIKey | XTBNXSKCTLZMHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)