Products 1256794-74-7
CAS 1256794-74-7 appears in our catalog under these names: 6-Chloro-4-(4-chlorophenyl)pyridine-3-carboxylic acid, 95%, 6-Chloro-4-(4-chlorophenyl)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 250mg.
6-chloro-4-(4-chlorophenyl)pyridine-3-carboxylic acid (CAS 1256794-74-7) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 6-chloro-4-(4-chlorophenyl)pyridine-3-carboxylic acid. InChIKey: RQKIPKLSFPBJKZ-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 6-chloro-4-(4-chlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | RQKIPKLSFPBJKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=C2C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)