CAS 1261912-00-8 is the registry number for 6-(2,4-Dichlorophenyl)picolinic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(2,4-dichlorophenyl)pyridine-2-carboxylic acid (CAS 1261912-00-8) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 6-(2,4-dichlorophenyl)pyridine-2-carboxylic acid. InChIKey: APXQBASWXZPQAJ-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 6-(2,4-dichlorophenyl)pyridine-2-carboxylic acid |
| InChIKey | APXQBASWXZPQAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)