Products 926255-89-2
CAS 926255-89-2 is the registry number for 5-(3,4-Dichlorophenyl)nicotinic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(3,4-dichlorophenyl)pyridine-3-carboxylic acid (CAS 926255-89-2) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)pyridine-3-carboxylic acid. InChIKey: ZZEBDRFZANYEQB-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | ZZEBDRFZANYEQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CN=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)