CAS 1365271-51-7 is the registry number for 1,2-Dichloro-4-(3-nitrophenyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1,2-dichloro-4-(3-nitrophenyl)benzene (CAS 1365271-51-7) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 1,2-dichloro-4-(3-nitrophenyl)benzene. InChIKey: JRUIENJXVUJBCT-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 1,2-dichloro-4-(3-nitrophenyl)benzene |
| InChIKey | JRUIENJXVUJBCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)