CAS 887978-52-1 appears in our catalog under these names: 1-(4-Methylphenyl)-4-oxocyclohexanecarboxylic acid, 4-Oxo-1-(p-tolyl)cyclohexanecarboxylic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(4-methylphenyl)-4-oxocyclohexane-1-carboxylic acid (CAS 887978-52-1) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 1-(4-methylphenyl)-4-oxocyclohexane-1-carboxylic acid. InChIKey: IGJQKWIMCAZJCO-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 1-(4-methylphenyl)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | IGJQKWIMCAZJCO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CCC(=O)CC2)C(=O)O |
Computed by PubChem (NCBI)