Products 887979-15-9
CAS 887979-15-9 is the registry number for 5-(3-Bromophenyl)-1,2-oxazole-3-carboxylic acid, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
5-(3-bromophenyl)-1,2-oxazole-3-carboxylic acid (CAS 887979-15-9) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 5-(3-bromophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: HFKRALPUNLGDQX-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | HFKRALPUNLGDQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)